Canagliflozin hemihydrate
Canagliflozin hemihydrate is the hemihydrate form of canagliflozin, which is a SGLT2 inhibitor with IC50 of 2.2 nM for hSGLT2 in a cell-free assay, exhibits 413-fold selectivity over hSGLT1.
| Trivial name | N/A |
| Catalog Number | S5901 |
| Molecular Formula | C30H27N5O2 |
| CAS# | 928672-86-0 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | COC1=CC=C(C=C1)C2=C(NC3=CC=CC=N3)NC4=C(C5=CCCCC5)C(=N[N]4C2=O)C6=CC=CC=C6 |
| Size | 10mg |
| Supplier Page | http://www.selleckchem.com/products/canagliflozin-hemihydrate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/canagliflozin-hemihydrate-chemical-structure-s5901.gif |