4′-Methoxychalcone
4′-Methoxychalcone, found in citrus, is chalcone derivative that has shown diverse pharmacological properties, including anti-tumor and anti-inflammatory activities. 4′-Methoxychalcone significantly enhanced adipocyte differentiation, in part, by its potent effects on PPARγ activation and by its reverse effect on TNF-α.
| Trivial name | N/A |
| Catalog Number | S5851 |
| Molecular Formula | C17H15BrN4O2S |
| CAS# | 959-23-9 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | COC1=CC(=C(Br)C=C1O)\C=N\[N]2C(=NN=C2C3=CC=CC=C3)SC |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/4-methoxychalcone.html |
| Additional Information | https://file.selleck.cn/downloads/struct/4-methoxychalcone-chemical-structure-s5851.gif |
