Frovatriptan Succinate
Frovatriptan Succinate(SB 209509 Succinate,VML 251 Succinate) is the succinate salt form of frovatriptan, a synthetic triptan with serotonin (5-HT) receptor agonist activity especially for the 5-HT1B/1D receptors.
| Trivial name | SB 209509 Succinate,VML 251 Succinate |
| Catalog Number | S5848 |
| Molecular Formula | C11H18ClN7O |
| CAS# | 158930-09-7 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CCN(C(C)C)C1=C(Cl)N=C(C(=N1)N)C(=O)NC(N)=N |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/frovatriptan-succinate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/frovatriptan-succinate-chemical-structure-s5848.gif |