p-Coumaric acid ethyl ester
p-Coumaric acid ethyl ester is the ethyl ester of p-Coumaric acid, which is a plant metabolite which exhibits antioxidant and anti-inflammatory properties.
| Trivial name | N/A |
| Catalog Number | S5834 |
| Molecular Formula | C14H11NO3 |
| CAS# | 7362-39-2 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CC1(C)C(=O)N=C2C3=CC=CC=C3C(=O)C(=C12)O |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/p-coumaric-acid-ethyl-ester.html |
| Additional Information | https://file.selleck.cn/downloads/struct/p-coumaric-acid-ethyl-ester-chemical-structure-s5834.gif |