Cinnamyl alcohol
Cinnamyl alcohol is a naturally occurring compound that is found within cinnamon. Cinnamyl alcohol can be significantly attenuated the enhanced expression of obesity-related proteins PPARγ in MDI medium-cultivated 3T3-L1 cells.
| Trivial name | N/A |
| Catalog Number | S5824 |
| Molecular Formula | C21H21FN6O3 |
| CAS# | 104-54-1 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CC1CNC(=O)C2=C3N=C4N(CC5=C(O1)N=CC(=C5)F)C6CCCC6OC4=C[N]3N=C2 |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/cinnamyl-alcohol.html |
| Additional Information | https://file.selleck.cn/downloads/struct/cinnamyl-alcohol-chemical-structure-s5824.gif |