MRE-269 (ACT-333679)
MRE-269 (ACT-333679) is a prostaglandin I2 (IP) receptor agonist with a binding affinity for the human IP receptor that is 130-fold greater than that for other human prostanoid receptor.
| Trivial name | N/A |
| Catalog Number | S5819 |
| Molecular Formula | C22H21F4N5O3 |
| CAS# | 475085-57-5 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | COC1=CC=C(F)C=C1C(=O)NCC2=CC=C(C=C2)C3=N[N](C(C)C(F)(F)F)C(=C3C(N)=O)N |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/mre-269-act-333679.html |
| Additional Information | https://file.selleck.cn/downloads/struct/mre-269-act-333679-chemical-structure-s5819.gif |