UF010
UF010 is a class I HDAC-selective inhibitor with IC50 values of 0.5 nM, 0.1 nM, 0.06 nM, 1.5 nM, 9.1 nM and 15.3 nM for HDAC1, HDAC2, HDAC3, HDAC8, HDAC6 and HDAC10, respectively.
| Trivial name | N/A |
| Catalog Number | S5810 |
| Molecular Formula | C20H17FN2O4S |
| CAS# | 537672-41-6 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CC1=CC(=CC(=C1F)C(=O)NN[S](=O)(=O)C2=CC(=CC=C2)O)C3=CC=CC=C3 |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/uf010.html |
| Additional Information | https://file.selleck.cn/downloads/struct/uf010-chemical-structure-s5810.gif |