lurasidone
Lurasidone (SM-13496) is a second-generation antipsychotic agent that exhibits full antagonism at dopamine D2 and serotonin 5-HT2A receptors with binding affinities Ki = 1 nM and Ki = 0.5 nM, respectively. It also has high affinity for serotonin 5-HT7 receptors (Ki = 0.5 nM), partial agonist activity at 5-HT1A receptors (Ki = 6.4 nM) and lacks affinity for histamine H1 and muscarinic M1 receptors.
| Trivial name | SM-13496 |
| Catalog Number | S5714 |
| Molecular Formula | C17H16N4O3 |
| CAS# | 367514-87-2 |
| SMILES | CCCN1C(NC2=CC=CC=C12)=NC(=O)C3=CC(=CC=C3)[N+]([O-])=O |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/lurasidone.html |
| Additional Information | https://file.selleck.cn/downloads/struct/lurasidone-chemical-structure-s5714.gif |
