Ketorolac tromethamine salt
Ketorolac tromethamine is a synthetic pyrrolizine carboxylic acid derivative with anti-inflammatory, analgesic and antipyretic properties. It is a non-selective COX inhibitor with IC50s of 20 nM for both COX-1 and COX-2.
| Trivial name | RS37619 |
| Catalog Number | S5698 |
| Molecular Formula | C30H33N5O2 |
| CAS# | 74103-07-4 |
| SMILES | C[N]1N=NC(=C1C2=CC3=C(N=C2)C4=C(C=C(C=C4)C(C)(C)O)[N]3C(C5CCOCC5)C6=CC=CC=C6)C |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/ketorolac-tromethamine-salt.html |
| Additional Information | https://file.selleck.cn/downloads/struct/ketorolac-tromethamine-salt-chemical-structure-s5698.gif |
