Tropolone (NSC 89303)
Tropolone (NSC 89303, 2-Hydroxytropone, Purpurocatechol), a metal chelator, possesses weak antioxidative and radical-scavenging properties and shows a strong affinity for ferric ion. It is able to inhibit ferric iron reduction by catecholates, lowering the redox potential of the iron couple.
| Trivial name | 2-Hydroxytropone, Purpurocatechol |
| Catalog Number | S5688 |
| Molecular Formula | C12H8N4O6S |
| CAS# | 533-75-5 |
| SMILES | N[S](=O)(=O)C1=C2C(=CC=C1)C3=C(NC(=O)C(=O)N3)C=C2[N+]([O-])=O |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/tropolone.html |
| Additional Information | https://file.selleck.cn/downloads/struct/tropolone-chemical-structure-s5688.gif |