L-Valine
Valine is a branched-chain essential amino acid that has stimulant activity and promotes muscle growth and tissue repair. It is a precursor in the penicillin biosynthetic pathway.
| Trivial name | N/A |
| Catalog Number | S5628 |
| Molecular Formula | C16H14FN5O2 |
| CAS# | 72-18-4 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CC1(C2=C(C=C(C=C2)C3=CNN=C3)C(=O)N1)C4=NC=NC=C4F.O |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/l-valine.html |
| Additional Information | https://file.selleck.cn/downloads/struct/l-valine-chemical-structure-s5628.gif |