Hippuric acid
Hippuric Acid (2-Benzamidoacetic acid, Benzoylglycine) is an acyl glycine produced by the conjugation of benzoic acid and glycine, found as a normal component in urine as a metabolite of aromatic compounds from food.
| Trivial name | 2-Benzamidoacetic acid, Benzoylglycine |
| Catalog Number | S5618 |
| Molecular Formula | C57H65F5N10O8 |
| CAS# | 495-69-2 |
| SMILES | CC(C(C(=O)N1CCCC1C2=NC3=C(N2)C=C(C(=C3)F)C4CCC(N4C5=CC(=C(C(=C5)F)N6CCC(CC6)C7=CC=C(C=C7)F)F)C8=CC9=C(C=C8F)N=C(N9)C1CCCN1C(=O)C(C(C)OC)NC(=O)OC)NC(=O)OC)OC |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/hippuric-acid.html |
| Additional Information | https://file.selleck.cn/downloads/struct/hippuric-acid-chemical-structure-s5618.gif |
