Flavokawain A
Flavokawain A, extracted from kava, is an apoptotic inducers and anticarcinogenic agent. Flavokawain A can down-regulation of antiapoptotic proteins, such as XIAP, survivin, and Bcl-xL, thereby changing the balance between apoptotic and antiapoptotic molecules and then induce cell death in tumor cells.
| Trivial name | N/A |
| Catalog Number | S5600 |
| Molecular Formula | C30H40Cl2N2O2 |
| CAS# | 3420-72-2 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CCNCCC1=CC=C(C=C1)CN(CC)C2=C(C=CC(=C2)OC)C3CCC4=C(C3)C=CC(=C4)O |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/flavokawain-a.html |
| Additional Information | https://file.selleck.cn/downloads/struct/flavokawain-a-chemical-structure-s5600.gif |
