Ethacrynic Acid
Ethacrynic Acid is a loop or high ceiling diuretic used for the treatment of high blood pressure and edema caused by diseases like congestive heart failure, liver failure, and kidney failure.
| Trivial name | N/A |
| Catalog Number | S5561 |
| Molecular Formula | C23H22N8O |
| CAS# | 58-54-8 |
| SMILES | CC1=C(C=CC=C1C2=CC(=NC(=N2)N)C3=CN(N=N3)CC4=NC(=CC=C4)C(C)(C)O)C#N |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/ethacrynic-acid.html |
| Additional Information | https://file.selleck.cn/downloads/struct/ethacrynic-acid-chemical-structure-s5561.gif |
