β-Alanine
β-Alanine (beta-Alanine, 3-Aminopropanoic acid) is a naturally occurring beta amino acid formed in vivo by the degradation of dihydrouracil and carnosine. It acts as a neurotransmitter by activating glycine and GABA receptors.
| Trivial name | beta-Alanine, 3-Aminopropanoic acid |
| Catalog Number | S5526 |
| Molecular Formula | C14H9BrN6O |
| CAS# | 107-95-9 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | BrC1=CC=CC=C1NC(=O)NC2=CC=C(C#N)C3=C2[NH]N=N3 |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/beta-alanine.html |
| Additional Information | https://file.selleck.cn/downloads/struct/beta-alanine-chemical-structure-s5526.gif |