Taurocholic acid sodium salt hydrate
Taurocholic acid (Sodium taurocholate hydrate), a bile salt formed in the liver, is the product of conjugation of cholic acid with taurine that is involved in the emulsification of lipids. Its sodium salt is the chief ingredient of the bile of carnivorous animals.Taurocholic acid sodium salt hydrate can be used to induce animal models of Severe Acute Pancreatitis (SAP).
| Trivial name | Sodium taurocholate hydrate |
| Catalog Number | S5130 |
| Molecular Formula | C16H12O5 |
| CAS# | 345909-26-4 |
| Inchi | InChI=1S/C16H12O5/c1-20-15-6-11-14(7-13(15)18)21-8-12(16(11)19)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 |
| Inchi Key | DXYUAIFZCFRPTH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=O)C(=CO2)C3=CC=C(C=C3)O)O |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/taurocholic-acid-sodium-salt-hydrate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/taurocholic-acid-sodium-salt-hydrate-chemical-structure-s5130.gif |
