Dabrafenib Mesylate
Dabrafenib Mesylate (GSK2118436) is the mesylate salt form of dabrafenib, an orally bioavailable inhibitor of B-raf (BRAF) protein with IC50s of 0.8 nM, 3.2 nM and 5 nM for B-Raf (V600E), B-Raf (WT) and C-Raf, respectively.
| Trivial name | GSK2118436 Mesylate |
| Catalog Number | S5069 |
| Molecular Formula | C20H18NO4 |
| CAS# | 1195768-06-9 |
| Inchi | InChI=1S/C20H18NO4/c1-22-17-4-3-12-7-16-14-9-19-18(24-11-25-19)8-13(14)5-6-21(16)10-15(12)20(17)23-2/h3-4,7-10H,5-6,11H2,1-2H3/q+1 |
| Inchi Key | YBHILYKTIRIUTE-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/dabrafenib-mesylate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/dabrafenib-mesylate-chemical-structure-s5069.gif |
