Minodronic acid
Minodronic acid (YM529, ONO-5920) is a third-generation nitrogen-cotaining bisphosphonate that is used for the treatment of osteoporosis. Minodronic acid is an aminobisphosphonate that is a selective antagonist of purinergic P2X2/3 receptors involved in pain.
| Trivial name | YM529, ONO-5920 |
| Catalog Number | S5057 |
| Molecular Formula | C9H12N2O7P2 |
| CAS# | 180064-38-4 |
| Inchi | InChI=1S/C9H12N2O7P2/c12-9(19(13,14)15,20(16,17)18)5-7-6-10-8-3-1-2-4-11(7)8/h1-4,6,12H,5H2,(H2,13,14,15)(H2,16,17,18) |
| Inchi Key | VMMKGHQPQIEGSQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(N2C=C1)CC(O)(P(=O)(O)O)P(=O)(O)O |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/minodronic-acid.html |
| Additional Information | https://file.selleck.cn/downloads/struct/minodronic-acid-chemical-structure-s5057.gif |