Dinoprost tromethamine
Dinoprost Tromethamine (Dinolytic, PGF2-alpha tham, Zinoprost, Prostin F2 alpha, Dinoprost Trometamol) is a synthetic analogue of the naturally occurring prostaglandin F2 alpha, which stimulates myometrial activity, relaxes the cervix, inhibits corpus luteal steroidogenesis, and induces luteolysis by direct action on the corpus luteum.
| Trivial name | Dinolytic, PGF2-alpha tham, Zinoprost, Prostin F2 alpha, Dinoprost Trometamol |
| Catalog Number | S5056 |
| Molecular Formula | C21H20O10 |
| CAS# | 38562-01-5 |
| Inchi | InChI=1S/C21H20O10/c22-7-14-17(26)19(28)20(29)21(31-14)16-11(25)6-13-15(18(16)27)10(24)5-12(30-13)8-1-3-9(23)4-2-8/h1-6,14,17,19-23,25-29H,7H2/t14-,17-,19+,20-,21+/m1/s1 |
| Inchi Key | MYXNWGACZJSMBT-VJXVFPJBSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=O)C3=C(O2)C=C(C(=C3O)C4C(C(C(C(O4)CO)O)O)O)O)O |
| Size | 10mg |
| Supplier Page | http://www.selleckchem.com/products/dinoprost-tromethamine.html |
| Additional Information | https://file.selleck.cn/downloads/struct/dinoprost-tromethamine-chemical-structure-s5056.gif |
