Fumaric acid
Fumaric acid (Fumarate, 2-Butenedioic acid, Trans-Butenedioic acid) is an intermediate in the citric acid cycle used by cells to produce energy in the form of adenosine triphosphate (ATP) from food; also a product of the urea cycle.
| Trivial name | 2-Butenedioic acid, Trans-Butenedioic acid, Allomaleic acid, Boletic acid, Donitic acid, Lichenic acid, Fumarate |
| Catalog Number | S4952 |
| Molecular Formula | C4H4O4 |
| CAS# | 110-17-8 |
| Inchi | InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1+ |
| Inchi Key | VZCYOOQTPOCHFL-OWOJBTEDSA-N |
| SMILES | C(=CC(=O)O)C(=O)O |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/fumaric-acid.html |
| Additional Information | https://file.selleck.cn/downloads/struct/fumaric-acid-chemical-structure-s4952.gif |