2,3-Dihydroxybenzoic acid
2,3-Dihydroxybenzoic acid (Pyrocatechuic acid, 3-Hydroxysalicylic acid, Hypogallic acid) is a natural phenol found in Phyllanthus acidus and in the aquatic fern Salvinia molesta, also a product of human aspirin metabolism. It is a potentially useful iron-chelating drug and has antimicrobial properties.
| Trivial name | Pyrocatechuic acid, O-Pyrocatechuic acid, 2-Pyrocatechuic acid, 3-Hydroxysalicylic acid, Hypogallic acid |
| Catalog Number | S4946 |
| Molecular Formula | C31H28N6O2 |
| CAS# | 303-38-8 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CN1C=C(N=C1)CN2C=CC3=C2C=C(C=C3)CNCC4=C(C5=CC=CC=C5N4)C6C7=C(C=CC(=C7)O)C(=O)N6 |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/2-3-dihydroxybenzoic-acid.html |
