Proxyphylline
Proxyphylline (Monophylline, Spasmolysin) is a derivative of theophylline which is used as a bronchodilator and for its cardiovascular properties. It selectively antagonizes A1 adenosine receptors (Ki = 82 nM for bovine brain) versus A2 adenosine receptors (Ki = 850 µM for platelets).
| Trivial name | Monophylline, Spasmolysin |
| Catalog Number | S4932 |
| Molecular Formula | C15H11ClF3NO |
| CAS# | 603-00-9 |
| SMILES | C1=CC=C(C(=C1)C(=O)CCl)NC2=CC=CC(=C2)C(F)(F)F |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/proxyphylline.html |
| Additional Information | https://file.selleck.cn/downloads/struct/proxyphylline-chemical-structure-s4932.gif |