Elagolix Sodium
Elagolix Soidum (NBI-56418, ABT-620) is a potent, selective, orally active, non-peptide antagonist of the gonadotropin-releasing hormone receptor (GnRHR) with Kd value of 54 pM. Concentration at 10 μM shows no significant activity on ion channels, enzymes, and transporters (inhibition <50%).
| Trivial name | NBI-56418, ABT-620 |
| Catalog Number | S4896 |
| Molecular Formula | C25H27N3O3 |
| CAS# | 832720-36-2 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | C1CN(CCC1(C(=O)NCC(=O)O)NC2=CC=CC=C2)CC3=CC=CC4=CC=CC=C43 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/elagolix-sodium.html |
| Additional Information | https://file.selleck.cn/downloads/struct/elagolix-Sodium-chemical-structure-s4896.gif |