Oxindole
Oxindole (2-indolone, 2-Oxindole, Indolin-2-one) is an aromatic heterocyclic organic compound which causes sedation, muscle weakness, hypotension, and coma when dosed in excess. Oxindole has anti-cancer, anti-HIV, anti-diabetic, antibacterial and other pharmacological activities.
| Trivial name | 2-indolone, 2-Oxindole, Indolin-2-one |
| Catalog Number | S4861 |
| Molecular Formula | C17H19N5OS |
| CAS# | 59-48-3 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CC1=C(C=NN1)C2=CC3=C(S2)C(=O)NC(=N3)C4CC5CCN4CC5 |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/oxindole.html |
| Additional Information | https://file.selleck.cn/downloads/struct/oxindole-chemical-structure-s4861.gif |
