L-Cysteine HCl
L-cysteine Hydrochloride, also known as L-CYSTEINE or Cysteine HCL (anhydrous), is classified as a cysteine or a cysteine derivative that increases glutathione levels and is important for lung and brain function and liver detoxification.
| Trivial name | N/A |
| Catalog Number | S4815 |
| Molecular Formula | C25H16Cl2F6N2O2 |
| CAS# | 52-89-1 |
| SMILES | CN1C(=CC(=N1)C(F)(F)F)C2=C(C(=C(C=C2)OCC3=CC=C(C=C3)Cl)C4=CC(=C(C=C4)Cl)C(F)(F)F)O |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/l-cysteine-hcl.html |
| Additional Information | https://file.selleck.cn/downloads/struct/l-cysteine-hcl-chemical-structure-S4815.gif |