1-Naphthyl acetate
1-Naphthyl acetate is usually used in a rapid staining method for identification of macrophages. 1-Naphthyl acetate is a potent chromogenic substrate for the detection of erythrocyte acetylcholinesterase (AChE) activity.
| Trivial name | N/A |
| Catalog Number | S4804 |
| Molecular Formula | C16H14Cl2N8O |
| CAS# | 830-81-9 |
| SMILES | CC1=NC2=C(N1)C=C(C=C2)N3C4=C(C=NC=C4)N=C3C5=NON=C5N.Cl.Cl |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/1-naphthyl-acetate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/1-naphthyl-acetate-chemical-structure-s4804.gif |