Benzyl isothiocyanate
Benzyl isothiocyanate (BITC, Benzoylthiocarbimide, Isothiocyanic Acid Benzoyl Ester) is an isothiocyanate originally found in cruciferous vegetables that exhibits immunomodulatory, anti-parasitic, antibiotic, antioxidative, anti-atherosclerotic, anti-angiogenic, anti-metastatic, anticancer chemotherapeutic, and chemopreventive activities.
| Trivial name | Benzoylthiocarbimide, Isothiocyanic Acid Benzoyl Ester |
| Catalog Number | S4783 |
| Molecular Formula | C21H20Cl2N10O |
| CAS# | 622-78-6 |
| SMILES | CN1C=C(C=N1)N2C=NC3=C(N=C(N=C32)N4CCOCC4)NCC5=NC6=CC(=C(C=C6N5)Cl)Cl |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/benzyl-isothiocyanate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/benzyl-isothiocyanate-chemical-structure-s4783.gif |
