Tiagabine hydrochloride
Tiagabine Hydrochloride (Gabitril, NO050328, NO328, TGB) is the hydrochloride salt form of tiagabine, a nipecotic acid derivative with anticonvulsant property. A selective gamma-aminobutyric acid (GABA) reuptake inhibitor.
| Trivial name | Gabitril hydrochloride, NO050328 hydrochloride, NO328 hydrochloride, TGB hydrochloride |
| Catalog Number | S4661 |
| Molecular Formula | C15H18Br2N4.xHCl |
| CAS# | 145821-59-6 |
| Inchi | InChI=1S/C15H18Br2N4.ClH/c1-9-11(16)12(17)10-3-2-6-21-14(10)13(9)19-15(21)20-7-4-18-5-8-20;/h18H,2-8H2,1H3;1H |
| Inchi Key | GQXLWUCQESKBSC-UHFFFAOYSA-N |
| SMILES | CC1=C2C3=C(CCCN3C(=N2)N4CCNCC4)C(=C1Br)Br |
| Size | 20mg |
| Supplier Page | http://www.selleckchem.com/products/tiagabine-hydrochloride.html |
| Additional Information | https://file.selleck.cn/downloads/struct/tiagabine-hydrochloride-chemical-structure-s4661.gif |
