Vinblastine sulfate
Vinblastine sulfate inhibits microtubule formation and suppresses nAChR activity with IC50 of 8.9 μM in a cell-free assay, used to treat certain kinds of cancer. Vinblastine sulfate induces autophagy and apoptosis.
| Trivial name | NSC-49842, Vincaleukoblastine, 29060-LE |
| Catalog Number | S4505 |
| Molecular Formula | C39H39Cl2N5O4 |
| CAS# | 143-67-9 |
| SMILES | CC1CN(C(=O)C2=C(C3=C(N12)C(=C(C=C3)Cl)C4=C(N(N=C4C)C)C)CCCOC5=CC(=C(C(=C5)C)Cl)C)C6=CN(C7=C6C=C(C=C7)C(=O)O)C |
| Size | 100mg |
| Supplier Page | http://www.selleckchem.com/products/vinblastine-sulfate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/vinblastine-sulfate-chemical-structure-s4505.gif |