Terfenadine
Terfenadine is an antihistamine, generally completely metabolizes to the active form fexofenadine in the liver by the enzyme cytochrome P450 CYP3A4 isoform. Terfenadine ((±)-Terfenadine) is a potent open-channel blocker of hERG with an IC50 of 204 nM. Terfenadine, an H1 histamine receptor antagonist, acts as a potent apoptosis inducer in melanoma cells through modulation of Ca2+ homeostasis. Terfenadine induces ROS-dependent apoptosis, simultaneously activates Caspase-4, -2, -9.
| Trivial name | N/A |
| Catalog Number | S4353 |
| Molecular Formula | C30H31F3N8O3S |
| CAS# | 50679-08-8 |
| Inchi | InChI=1S/C30H31F3N8O3S/c1-18-6-7-22(37-27(43)20-4-3-5-21(14-20)30(31,32)33)15-23(18)38-28(44)24-17-34-29(45-24)39-25-16-26(36-19(2)35-25)41-10-8-40(9-11-41)12-13-42/h3-7,14-17,42H,8-13H2,1-2H3,(H,37,4 3)(H,38,44)(H,34,35,36,39) |
| Inchi Key | ANEBQUSWQAQFQB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C2=CC(=CC=C2)C(F)(F)F)NC(=O)C3=CN=C(S3)NC4=CC(=NC(=N4)C)N5CCN(CC5)CCO |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/terfenadine.html |
| Additional Information | https://file.selleck.cn/downloads/struct/terfenadine-chemical-structure-s4353.gif |