Tasimelteon
Tasimelteon (BMS 214778, VEC 162) is a selective dual melatonin receptor (MT1/MT2) agonist with 2.1-4.4 times greater affinity for the MT2 receptor believed to mediate circadian rhythm phase-shifting (Ki = 0.0692 nM and Ki = 0.17 nM in NIH-3T3 and CHOeK1 cells, respectively), than for the MT1 receptor (Ki = 0.304 nM and Ki = 0.35 nM, respectively).
| Trivial name | BMS 214778, VEC 162 |
| Catalog Number | S4281 |
| Molecular Formula | C32H28F3N5O4 |
| CAS# | 609799-22-6 |
| SMILES | CCOC1=CC=C(C=C1)N2C(=O)C3=CC=CN=C3N=C2C(C)N(CC4=CC=CN=C4)C(=O)CC5=CC=C(OC(F)(F)F)C=C5 |
| Size | 10mg |
| Supplier Page | http://www.selleckchem.com/products/tasimelteon.html |
| Additional Information | https://file.selleck.cn/downloads/struct/tasimelteon-chemical-structure-s4281.gif |