Histamine
Histamine, an organic nitrogenous compound, is involved in local immune responses regulating physiological function in the gut and acting as a neurotransmitter for the brain, spinal cord, and uterus. It is a potent H1 and H2 receptor agonist. Histamine can be used to induce animal models of Gastric and Intestinal Ulcers.
| Trivial name | N/A |
| Catalog Number | S3968 |
| Molecular Formula | C82H107N5O20 |
| CAS# | 51-45-6 |
| SMILES | CCC(C1=CC(=C(C(=C1)OC)OC)OC)C(=O)N2CCCCC2C(=O)OC(CCC3=CC(=C(C=C3)OC)OC)C4=CC(=CC=C4)OCC(=O)NCC(CNC(=O)COC5=CC=CC(=C5)C(CCC6=CC(=C(C=C6)OC)OC)OC(=O)C7CCCCN7C(=O)C(CC)C8=CC(=C(C(=C8)OC)OC)OC)CN(C)C |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/histamine.html |
| Additional Information | https://file.selleck.cn/downloads/struct/histamine-chemical-structure-s3968.gif |
