Hederagenin
Hederagenin (Caulosapogenin, Hederagenol, Hederagenic acid, Astrantiagenin E) is a highly water insoluble triterpenoid compound that can be found in various plants including Hedera helix and Chenopodium quinoa. It exhibits a variety of biological activities, including potent antitumor properties both in vitro and in vivo. Hederagenin inhibits LPS-stimulated expression of iNOS, COX-2, and NF-κB.
| Trivial name | Caulosapogenin, Hederagenol, Hederagenic acid, Astrantiagenin E |
| Catalog Number | S3899 |
| Molecular Formula | C26H29NO5 |
| CAS# | 465-99-6 |
| Inchi | InChI=1S/C26H29NO5/c1-31-25(30)19-2-7-23(28)22(11-19)27-24(29)15-32-21-5-3-20(4-6-21)26-12-16-8-17(13-26)10-18(9-16)14-26/h2-7,11,16-18,28H,8-10,12-15H2,1H3,(H,27,29) |
| Inchi Key | BJRPPNOJYFZSLY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)O)NC(=O)COC2=CC=C(C=C2)C34CC5CC(C3)CC(C5)C4 |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/hederagenin.html |
| Additional Information | https://file.selleck.cn/downloads/struct/hederagenin-chemical-structure-s3899.gif |