α-L-Rhamnose monohydrate
α-L-Rhamnose monohydrate (6-deoxy-L-mannose monohydrate, α-L-Rhamnopyranose monohydrate) is used as a starting material for the production of furanones. It is an important material involved in the reaction of flavors developed during the preparation of various foods like bread, grilled meats, etc.
| Trivial name | 6-deoxy-L-mannose monohydrate, α-L-Rhamnopyranose monohydrate |
| Catalog Number | S3887 |
| Molecular Formula | C13H18N2O5S |
| CAS# | 6155-35-7 |
| Inchi | InChI=1S/C13H18N2O5S/c1-21(18,19)14-12-8-7-10(15(16)17)9-13(12)20-11-5-3-2-4-6-11/h7-9,11,14H,2-6H2,1H3 |
| Inchi Key | KTDZCOWXCWUPEO-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=C(C=C(C=C1)[N+](=O)[O-])OC2CCCCC2 |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/a-l-rhamnose-monohydrate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/l-rhamnose-monohydrate-chemical-structure-s3887.gif |