Obacunone (AI3-37934)
Obacunone (AI3-37934, CCRIS 8657), a natural compound present in citrus fruits, has been demonstrated for various biological activities including anti-cancer and anti-inflammatory properties. It significantly inhibits aromatase activity in an in vitro enzyme assay with an IC50 value of 28.04 μM; also a novel activator of Nrf2.
| Trivial name | CCRIS 8657 |
| Catalog Number | S3784 |
| Molecular Formula | C18H22N6O.2HCl |
| CAS# | 751-03-1 |
| Inchi | InChI=1S/C18H22N6O.2ClH/c1-3-14(19)10-21-17-6-7-20-18(23-17)15-8-12(4-5-16(15)25)13-9-22-24(2)11-13;;/h4-9,11,14,25H,3,10,19H2,1-2H3,(H,20,21,23);2*1H/t14-;;/m1../s1 |
| Inchi Key | CXYCRYGNFKDPRH-FMOMHUKBSA-N |
| SMILES | CCC(CNC1=NC(=NC=C1)C2=C(C=CC(=C2)C3=CN(N=C3)C)O)N.Cl.Cl |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/obacunone.html |
| Additional Information | https://file.selleck.cn/downloads/struct/obacunone-chemical-structure-s3784.gif |
