L-Leucine
Leucine ((S)-Leucine, Leu) is one of nine essential amino acids in humans which is important for protein synthesis and many metabolic functions. It contributes to regulation of blood-sugar levels; growth and repair of muscle and bone tissue; growth hormone production; and wound healing. L-Leucine is an essential branched-chain amino acid (BCAA), which activates the mTOR signaling pathway.
| Trivial name | (S)-Leucine, Leu |
| Catalog Number | S3753 |
| Molecular Formula | C17H12F3NO4S |
| CAS# | 61-90-5 |
| Inchi | InChI=1S/C17H12F3NO4S/c1-26(23,24)14-3-2-13(12-7-17(19,20)16(22)15(12)14)25-11-5-9(8-21)4-10(18)6-11/h2-6,16,22H,7H2,1H3/t16-/m0/s1 |
| Inchi Key | ONBSHRSJOPSEGS-INIZCTEOSA-N |
| SMILES | CS(=O)(=O)C1=C2C(C(CC2=C(C=C1)OC3=CC(=CC(=C3)C#N)F)(F)F)O |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/l-leucine.html |
| Additional Information | https://file.selleck.cn/downloads/struct/i-ieucine-chemical-structure-s3753.gif |