DHBP dibromide
DHBP (1,1′-diheptyl-4,4′-bipyridinium), a viologen for electrochromic memory display agent, inhibits the calcium release induced by 2 mM caffeine and 2 μg/ml polylysine with an IC50 value of 5 μg/ml and 4 μg/ml respectively.
| Trivial name | 1,1'-diheptyl-4,4'-bipyridinium dibromide |
| Catalog Number | S3700 |
| Molecular Formula | C11H13IN4O4 |
| CAS# | 6159-05-3 |
| Inchi | InChI=1S/C11H13IN4O4/c12-4-1-16(10-6(4)9(13)14-3-15-10)11-8(19)7(18)5(2-17)20-11/h1,3,5,7-8,11,17-19H,2H2,(H2,13,14,15)/t5-,7+,8?,11-/m1/s1 |
| Inchi Key | WHSIXKUPQCKWBY-INWNYVOZSA-N |
| SMILES | C1=C(C2=C(N=CN=C2N1C3C(C(C(O3)CO)O)O)N)I |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/dhbp-dibromide.html |
| Additional Information | https://file.selleck.cn/downloads/struct/dhbp-dibromide-chemical-structure-s3700.gif |