Xevinapant (AT406)
Xevinapant (AT406, ARRY-334543, Debio1143, SM-406) is a potent Smac mimetic and an antagonist of IAP (inhibitor of apoptosis protein via E3 ubiquitin ligase), binding to XIAP-BIR3, cIAP1-BIR3 and cIAP2-BIR3 with Ki of 66.4 nM, 1.9 nM, and 5.1 nM, 50- to 100-fold higher affinities than the Smac AVPI peptide. Phase 1.
| Trivial name | ARRY-334543, Debio1143, SM-406 |
| Catalog Number | S2754 |
| Molecular Formula | C25H28N6O |
| CAS# | 1071992-99-8 |
| Inchi | InChI=1S/C25H28N6O/c1-15-11-22(31-13-16(2)27-17(3)14-31)26-12-21(15)18-5-7-19(8-6-18)23-28-24-20(25(32)29-23)9-10-30(24)4/h5-12,16-17,27H,13-14H2,1-4H3,(H,28,29,32)/t16-,17+ |
| Inchi Key | WCPTUQOMNJBIET-CALCHBBNSA-N |
| SMILES | CC1CN(CC(N1)C)C2=NC=C(C(=C2)C)C3=CC=C(C=C3)C4=NC5=C(C=CN5C)C(=O)N4 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/at-406.html |
| Additional Information | https://file.selleck.cn/downloads/struct/AT-406-chemical-structure-s2754.gif |
