Daidzin
Daidzin (Daidzoside, Daidzein 7-O-glucoside, Daidzein 7-glucoside), a natural organic compound in the class of phytochemicals known as isoflavones, is a potent and selective inhibitor of human mitochondrial aldehyde dehydrogenase and inhibits ALDH-I selectively (Ki=20 nM); at least 500 times less effective against ALDH-Ⅱ, the cytosolic isozyme (Ki=10 μM).
| Trivial name | Daidzoside, Daidzein 7-O-glucoside, Daidzein 7-glucoside |
| Catalog Number | S2289 |
| Molecular Formula | C29H31NO7 |
| CAS# | 552-66-9 |
| SMILES | CN(C)C(=O)C1C(C2(C(C1O)(C3=C(O2)C=C(C=C3OC)OC)O)C4=CC=C(C=C4)OC)C5=CC=CC=C5 |
| Size | 200mg |
| Supplier Page | http://www.selleckchem.com/products/Daidzin.html |
| Additional Information | https://file.selleck.cn/downloads/struct/Daidzin-chemical-structure-S2289.gif |
