Tipifarnib
Tipifarnib is a potent and specific farnesyltransferase (FTase) inhibitor with IC50 of 0.6 nM, its anti-proliferative effects are most prominent in H-ras or N-ras mutant cells. Phase 3.
| Trivial name | R115777, IND 58359 |
| Catalog Number | S1453 |
| Molecular Formula | C17H15ClN2 |
| CAS# | 192185-72-1 |
| SMILES | CC1=C2C=CN=CC2=C(C3=C1NC4=CC=CC=C43)C.Cl |
| Size | 10mg |
| Supplier Page | http://www.selleckchem.com/products/Tipifarnib(R115777).html |
| Additional Information | https://file.selleck.cn/downloads/struct/Tipifarnib-Zarnestra-chemical-structure-S1453.gif |
