L189
inhibitor of human DNA ligases I, III and IV DNA Damage/DNA Repair|DNA Ligases
| Catalog Number | B7426-10 |
| Research Area | DNA Damage/DNA Repair|DNA Ligases |
| Molecular Formula | C11H10N4OS |
| CAS# | 64232-83-3 |
| Purity | 98% |
| SMILES | S=C(NC1=O)NC(N)=C1/N=CC2=CC=CC=C2 |
| Size | 10mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B7426 |
