S 24795
Partial agonist of α7 nAChR Neuroscience|Nicotinic Receptor
| Catalog Number | B7418-10 |
| Research Area | Neuroscience|Nicotinic Receptor |
| Molecular Formula | C14H13BrINO |
| CAS# | 304679-75-2 |
| SMILES | C[N+]1=CC=CC=C1CC(C2=CC=C(Br)C=C2)=O.[I-] |
| Size | 10mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B7418 |
