Astemizole
anti-histamine compound, potent Neuroscience|Histamine Receptor
| Catalog Number | B7409-50 |
| Research Area | Neuroscience|Histamine Receptor |
| Molecular Formula | C28H31FN4O |
| CAS# | 68844-77-9 |
| Purity | 99.66% |
| SMILES | FC1=CC=C(C=C1)CN2C(NC3CCN(CCC(C=C4)=CC=C4OC)CC3)=NC5=CC=CC=C25 |
| Size | 50mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B7409 |
