Swainsonine
Inhibitor of α-mannosidase II which inhibits glycoprotein processing Others|Glycosylases
| Catalog Number | B7316-1 |
| Research Area | Others|Glycosylases |
| Molecular Formula | C8H15NO3 |
| CAS# | 72741-87-8 |
| Purity | 98% |
| SMILES | O[C@H]1[C@@H]([C@@H]2O)N(CCC2)C[C@H]1O |
| Size | 1mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B7316 |
