SB 399885 hydrochloride
5-HT6 antagonist GPCR/G protein|5-HT Receptor
| Catalog Number | B7309-50 |
| Research Area | GPCR/G protein|5-HT Receptor |
| Molecular Formula | C18H21Cl2N3O4S.HCl |
| CAS# | 402713-81-9 |
| SMILES | COC1=C(N2CCNCC2)C=C(S(NC3=CC(Cl)=CC(Cl)=C3OC)(=O)=O)C=C1.Cl |
| Size | 50mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B7309 |
