Citric acid
Commonly used laboratory reagent Others|Reagents
| Catalog Number | B7297-500000 |
| Research Area | Others|Reagents |
| Molecular Formula | C6H8O7 |
| CAS# | 77-92-9 |
| Purity | 99.75% |
| SMILES | OC(CC(O)=O)(C(O)=O)CC(O)=O |
| Size | 500g |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B7297 |
