PD-1/PD-L1 inhibitor 1
PD-1/PD-L1 interaction inhibitor Apoptosis|PD-1/PD-L1 interaction
| Catalog Number | B6172-5 |
| Research Area | Apoptosis|PD-1/PD-L1 interaction |
| Molecular Formula | C29H33NO5 |
| CAS# | 1675201-83-8 |
| Purity | 98.3% |
| SMILES | O=C([C@H]1N(CC2=C(OC)C=C(OCC3=CC=CC(C4=CC=CC=C4)=C3C)C=C2OC)CCCC1)O |
| Size | 5mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B6172 |
