Casin
GTPase Cdc42 inhibitor Cell Cycle/Checkpoint|Cdc42
| Catalog Number | B6103-50 |
| Research Area | Cell Cycle/Checkpoint|Cdc42 |
| Molecular Formula | C20H22N2O |
| CAS# | 425399-05-9 |
| Purity | 98.15% |
| SMILES | OCCNC1CCCC2=C1NC3=C2C=C(C4=CC=CC=C4)C=C3 |
| Size | 50mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B6103 |
