Bohemine
CDK inhibitor Cell Cycle/Checkpoint|Cyclin-Dependent Kinases
| Catalog Number | B6101-5 |
| Research Area | Cell Cycle/Checkpoint|Cyclin-Dependent Kinases |
| Molecular Formula | C18H24N6O |
| CAS# | 189232-42-6 |
| Purity | 99% |
| SMILES | CC(N1C=NC(C1=NC(NCCCO)=N2)=C2NCC3=CC=CC=C3)C |
| Size | 5mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B6101 |
