EPZ020411
PRMT6 inhibitor Chromatin/Epigenetics|Histone Methyltransferase
| Catalog Number | B6088-5 |
| Research Area | Chromatin/Epigenetics|Histone Methyltransferase |
| Molecular Formula | C25H38N4O3 |
| CAS# | 1700663-41-7 |
| Purity | 98% |
| SMILES | CN(CC1=CNN=C1C2=CC=C(O[C@@H]3C[C@@H](OCCC4CCOCC4)C3)C=C2)CCNC |
| Size | 5mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B6088 |
